C16H21F3OS — CID 10892511
(2R,3R)-4-cyclohexyl-1,1,1-trifluoro-3-phenylsulfanylbutan-2-ol (PubChem CID 10892511) has the molecular formula C16H21F3OS and a molecular weight of 318.40 g/mol. Its IUPAC name is (2R,3R)-4-cyclohexyl-1,1,1-trifluoro-3-phenylsulfanylbutan-2-ol.
| Compound Name | (2R,3R)-4-cyclohexyl-1,1,1-trifluoro-3-phenylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 10892511 |
| Molecular Formula | C16H21F3OS |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (2R,3R)-4-cyclohexyl-1,1,1-trifluoro-3-phenylsulfanylbutan-2-ol |
| SMILES | O[C@@H]([C@@H](CC1CCCCC1)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H21F3OS/c17-16(18,19)15(20)14(11-12-7-3-1-4-8-12)21-13-9-5-2-6-10-13/h2,5-6,9-10,12,14-15,20H,1,3-4,7-8,11H2/t14-,15+/m1/s1 |
| InChIKey | XAJKMXJEEVNFQD-CABCVRRESA-N |
| XLogP | 5.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |