C25H24N4O3 — CID 108925934
N-[2-[[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 108925934) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[2-[[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925934 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[2-[[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1CNC(=O)C1CC(=O)N(Cc2ccccc2)C1)c1cccnc1 |
| InChI | InChI=1S/C25H24N4O3/c30-23-13-21(17-29(23)16-18-7-2-1-3-8-18)24(31)27-15-19-9-4-5-11-22(19)28-25(32)20-10-6-12-26-14-20/h1-12,14,21H,13,15-17H2,(H,27,31)(H,28,32) |
| InChIKey | MWFSKWGPKHNCIY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |