C20H34O3 — CID 10892635
(Z,5R)-2-[(1S,3R,4R)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-6-methylhept-2-ene-1,5,6-triol (PubChem CID 10892635) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (Z,5R)-2-[(1S,3R,4R)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-6-methylhept-2-ene-1,5,6-triol.
| Compound Name | (Z,5R)-2-[(1S,3R,4R)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-6-methylhept-2-ene-1,5,6-triol |
|---|---|
| PubChem CID | 10892635 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (Z,5R)-2-[(1S,3R,4R)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-6-methylhept-2-ene-1,5,6-triol |
| SMILES | C=C[C@@]1(C)CC[C@H](/C(=C/C[C@@H](O)C(C)(C)O)CO)C[C@@H]1C(=C)C |
| InChI | InChI=1S/C20H34O3/c1-7-20(6)11-10-15(12-17(20)14(2)3)16(13-21)8-9-18(22)19(4,5)23/h7-8,15,17-18,21-23H,1-2,9-13H2,3-6H3/b16-8+/t15-,17+,18+,20-/m0/s1 |
| InChIKey | LIIVAVMDEGBHMT-CEKIEGOGSA-N |
| XLogP | 3.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|