C27H23N3O6 — CID 108928240
[3-[[4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]phenyl]methylcarbamoyl]phenyl] acetate (PubChem CID 108928240) has the molecular formula C27H23N3O6 and a molecular weight of 485.50 g/mol. Its IUPAC name is [3-[[4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]phenyl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]phenyl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928240 |
| Molecular Formula | C27H23N3O6 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [3-[[4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]phenyl]methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCc2ccc(NC(=O)C(C)N3C(=O)c4ccccc4C3=O)cc2)c1 |
| InChI | InChI=1S/C27H23N3O6/c1-16(30-26(34)22-8-3-4-9-23(22)27(30)35)24(32)29-20-12-10-18(11-13-20)15-28-25(33)19-6-5-7-21(14-19)36-17(2)31/h3-14,16H,15H2,1-2H3,(H,28,33)(H,29,32) |
| InChIKey | PKSSGODADMQYGR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|