C28H25N3O6 — CID 108928355
[3-[[4-[[4-(1,3-dioxoisoindol-2-yl)butanoylamino]methyl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108928355) has the molecular formula C28H25N3O6 and a molecular weight of 499.52 g/mol. Its IUPAC name is [3-[[4-[[4-(1,3-dioxoisoindol-2-yl)butanoylamino]methyl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[4-[[4-(1,3-dioxoisoindol-2-yl)butanoylamino]methyl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928355 |
| Molecular Formula | C28H25N3O6 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | [3-[[4-[[4-(1,3-dioxoisoindol-2-yl)butanoylamino]methyl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccc(CNC(=O)CCCN3C(=O)c4ccccc4C3=O)cc2)c1 |
| InChI | InChI=1S/C28H25N3O6/c1-18(32)37-22-7-4-6-20(16-22)26(34)30-21-13-11-19(12-14-21)17-29-25(33)10-5-15-31-27(35)23-8-2-3-9-24(23)28(31)36/h2-4,6-9,11-14,16H,5,10,15,17H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | NFVCPJBFSFUZSU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|