C19H30N2O4 — CID 1089289
2,4,5-trimethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 1089289) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 2,4,5-trimethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 1089289 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 2,4,5-trimethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | COc1cc(OC)c(C(=O)NC2CC(C)(C)NC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C19H30N2O4/c1-18(2)10-12(11-19(3,4)21-18)20-17(22)13-8-15(24-6)16(25-7)9-14(13)23-5/h8-9,12,21H,10-11H2,1-7H3,(H,20,22) |
| InChIKey | VCQXNHXZRZZKPC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |