C22H19BrN2O6 — CID 108931945
[4-[[3-[(5-bromofuran-2-carbonyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108931945) has the molecular formula C22H19BrN2O6 and a molecular weight of 487.31 g/mol. Its IUPAC name is [4-[[3-[(5-bromofuran-2-carbonyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[3-[(5-bromofuran-2-carbonyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931945 |
| Molecular Formula | C22H19BrN2O6 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | [4-[[3-[(5-bromofuran-2-carbonyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCc2cccc(NC(=O)c3ccc(Br)o3)c2)cc1 |
| InChI | InChI=1S/C22H19BrN2O6/c1-2-29-22(28)30-17-8-6-15(7-9-17)20(26)24-13-14-4-3-5-16(12-14)25-21(27)18-10-11-19(23)31-18/h3-12H,2,13H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | PTBPXRNWDYTFAV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|