C18H21F3N2O2 — CID 108934358
(E)-3-cyclopentyl-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]but-2-enamide (PubChem CID 108934358) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is (E)-3-cyclopentyl-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]but-2-enamide.
| Compound Name | (E)-3-cyclopentyl-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 108934358 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (E)-3-cyclopentyl-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]but-2-enamide |
| SMILES | C/C(=C\C(=O)NCc1ccccc1NC(=O)C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C18H21F3N2O2/c1-12(13-6-2-3-7-13)10-16(24)22-11-14-8-4-5-9-15(14)23-17(25)18(19,20)21/h4-5,8-10,13H,2-3,6-7,11H2,1H3,(H,22,24)(H,23,25)/b12-10+ |
| InChIKey | BBZPZDHOVGOZHB-ZRDIBKRKSA-N |
| XLogP | 3.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|