C14H15F3N2O — CID 71889641
3-cyclopropyl-N'-[2-(trifluoromethyl)phenyl]but-2-enehydrazide (PubChem CID 71889641) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-cyclopropyl-N'-[2-(trifluoromethyl)phenyl]but-2-enehydrazide.
| Compound Name | 3-cyclopropyl-N'-[2-(trifluoromethyl)phenyl]but-2-enehydrazide |
|---|---|
| PubChem CID | 71889641 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-cyclopropyl-N'-[2-(trifluoromethyl)phenyl]but-2-enehydrazide |
| SMILES | CC(=CC(=O)NNc1ccccc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C14H15F3N2O/c1-9(10-6-7-10)8-13(20)19-18-12-5-3-2-4-11(12)14(15,16)17/h2-5,8,10,18H,6-7H2,1H3,(H,19,20) |
| InChIKey | SUWSRELTXWGQSQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|