C13H16N2O2S — CID 99840994
N'-[(E)-3-cyclopropylbut-2-enoyl]-5-methylthiophene-2-carbohydrazide (PubChem CID 99840994) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is N'-[(E)-3-cyclopropylbut-2-enoyl]-5-methylthiophene-2-carbohydrazide.
| Compound Name | N'-[(E)-3-cyclopropylbut-2-enoyl]-5-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 99840994 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N'-[(E)-3-cyclopropylbut-2-enoyl]-5-methylthiophene-2-carbohydrazide |
| SMILES | C/C(=C\C(=O)NNC(=O)c1ccc(C)s1)C1CC1 |
| InChI | InChI=1S/C13H16N2O2S/c1-8(10-4-5-10)7-12(16)14-15-13(17)11-6-3-9(2)18-11/h3,6-7,10H,4-5H2,1-2H3,(H,14,16)(H,15,17)/b8-7+ |
| InChIKey | SOJPBMBWXDAXHE-BQYQJAHWSA-N |
| XLogP | 2.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|