C20H21F3N2O3 — CID 55831849
4-cyclopentyloxy-3-methoxy-N'-[2-(trifluoromethyl)phenyl]benzohydrazide (PubChem CID 55831849) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is 4-cyclopentyloxy-3-methoxy-N'-[2-(trifluoromethyl)phenyl]benzohydrazide.
| Compound Name | 4-cyclopentyloxy-3-methoxy-N'-[2-(trifluoromethyl)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 55831849 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-cyclopentyloxy-3-methoxy-N'-[2-(trifluoromethyl)phenyl]benzohydrazide |
| SMILES | COc1cc(C(=O)NNc2ccccc2C(F)(F)F)ccc1OC1CCCC1 |
| InChI | InChI=1S/C20H21F3N2O3/c1-27-18-12-13(10-11-17(18)28-14-6-2-3-7-14)19(26)25-24-16-9-5-4-8-15(16)20(21,22)23/h4-5,8-12,14,24H,2-3,6-7H2,1H3,(H,25,26) |
| InChIKey | GBFSTJDBGYXEAY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|