C17H18F3N3O4S — CID 55343291
2-methoxy-N,N-dimethyl-5-[[2-(trifluoromethyl)anilino]carbamoyl]benzenesulfonamide (PubChem CID 55343291) has the molecular formula C17H18F3N3O4S and a molecular weight of 417.41 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethyl-5-[[2-(trifluoromethyl)anilino]carbamoyl]benzenesulfonamide.
| Compound Name | 2-methoxy-N,N-dimethyl-5-[[2-(trifluoromethyl)anilino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55343291 |
| Molecular Formula | C17H18F3N3O4S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-methoxy-N,N-dimethyl-5-[[2-(trifluoromethyl)anilino]carbamoyl]benzenesulfonamide |
| SMILES | COc1ccc(C(=O)NNc2ccccc2C(F)(F)F)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H18F3N3O4S/c1-23(2)28(25,26)15-10-11(8-9-14(15)27-3)16(24)22-21-13-7-5-4-6-12(13)17(18,19)20/h4-10,21H,1-3H3,(H,22,24) |
| InChIKey | RYBPOVXPQICKQN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|