C17H17F3N2O6S2 — CID 110166832
3-(dimethylsulfamoyl)-4-methoxy-N-[2-(trifluoromethyl)phenyl]sulfonylbenzamide (PubChem CID 110166832) has the molecular formula C17H17F3N2O6S2 and a molecular weight of 466.46 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-methoxy-N-[2-(trifluoromethyl)phenyl]sulfonylbenzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[2-(trifluoromethyl)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 110166832 |
| Molecular Formula | C17H17F3N2O6S2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[2-(trifluoromethyl)phenyl]sulfonylbenzamide |
| SMILES | COc1ccc(C(=O)NS(=O)(=O)c2ccccc2C(F)(F)F)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H17F3N2O6S2/c1-22(2)30(26,27)15-10-11(8-9-13(15)28-3)16(23)21-29(24,25)14-7-5-4-6-12(14)17(18,19)20/h4-10H,1-3H3,(H,21,23) |
| InChIKey | PRJKDUNIIHCCRW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |