C23H28N2O5 — CID 55833905
4-cyclopentyloxy-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-methoxybenzohydrazide (PubChem CID 55833905) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-cyclopentyloxy-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-methoxybenzohydrazide.
| Compound Name | 4-cyclopentyloxy-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 55833905 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 4-cyclopentyloxy-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-methoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)COc2cc(C)ccc2C)ccc1OC1CCCC1 |
| InChI | InChI=1S/C23H28N2O5/c1-15-8-9-16(2)20(12-15)29-14-22(26)24-25-23(27)17-10-11-19(21(13-17)28-3)30-18-6-4-5-7-18/h8-13,18H,4-7,14H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | LCQXOXLYXJYASL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|