C16H17F3N2O2 — CID 108934742
N-[[3-[(2-cyclopentylideneacetyl)amino]phenyl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 108934742) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is N-[[3-[(2-cyclopentylideneacetyl)amino]phenyl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[3-[(2-cyclopentylideneacetyl)amino]phenyl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 108934742 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[[3-[(2-cyclopentylideneacetyl)amino]phenyl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(C=C1CCCC1)Nc1cccc(CNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F3N2O2/c17-16(18,19)15(23)20-10-12-6-3-7-13(8-12)21-14(22)9-11-4-1-2-5-11/h3,6-9H,1-2,4-5,10H2,(H,20,23)(H,21,22) |
| InChIKey | NZYHYADTYOCLDW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|