C13H13NO2 — CID 108936008
(4Z)-2-ethyl-4-[(2-methylphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 108936008) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (4Z)-2-ethyl-4-[(2-methylphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-ethyl-4-[(2-methylphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936008 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (4Z)-2-ethyl-4-[(2-methylphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCC1=N/C(=C\c2ccccc2C)C(=O)O1 |
| InChI | InChI=1S/C13H13NO2/c1-3-12-14-11(13(15)16-12)8-10-7-5-4-6-9(10)2/h4-8H,3H2,1-2H3/b11-8- |
| InChIKey | GSADOQXVAIOUKE-FLIBITNWSA-N |
| XLogP | 2.70 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|