C18H16N2O2 — CID 108935913
(4E)-2-[2-(2-methylphenyl)ethyl]-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 108935913) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is (4E)-2-[2-(2-methylphenyl)ethyl]-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4E)-2-[2-(2-methylphenyl)ethyl]-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108935913 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (4E)-2-[2-(2-methylphenyl)ethyl]-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | Cc1ccccc1CCC1=N/C(=C/c2cccnc2)C(=O)O1 |
| InChI | InChI=1S/C18H16N2O2/c1-13-5-2-3-7-15(13)8-9-17-20-16(18(21)22-17)11-14-6-4-10-19-12-14/h2-7,10-12H,8-9H2,1H3/b16-11+ |
| InChIKey | SAUHGTUKCJDMLZ-LFIBNONCSA-N |
| XLogP | 3.32 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|