C21H21NO3 — CID 108936490
(4E)-4-[(3-ethoxyphenyl)methylidene]-2-[2-(2-methylphenyl)ethyl]-1,3-oxazol-5-one (PubChem CID 108936490) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (4E)-4-[(3-ethoxyphenyl)methylidene]-2-[2-(2-methylphenyl)ethyl]-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(3-ethoxyphenyl)methylidene]-2-[2-(2-methylphenyl)ethyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936490 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (4E)-4-[(3-ethoxyphenyl)methylidene]-2-[2-(2-methylphenyl)ethyl]-1,3-oxazol-5-one |
| SMILES | CCOc1cccc(/C=C2/N=C(CCc3ccccc3C)OC2=O)c1 |
| InChI | InChI=1S/C21H21NO3/c1-3-24-18-10-6-8-16(13-18)14-19-21(23)25-20(22-19)12-11-17-9-5-4-7-15(17)2/h4-10,13-14H,3,11-12H2,1-2H3/b19-14+ |
| InChIKey | WPDOTBQTWSAQOF-XMHGGMMESA-N |
| XLogP | 4.32 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|