C17H14N2O2 — CID 108935903
(4E)-2-(3,4-dimethylphenyl)-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 108935903) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is (4E)-2-(3,4-dimethylphenyl)-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(3,4-dimethylphenyl)-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108935903 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (4E)-2-(3,4-dimethylphenyl)-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | Cc1ccc(C2=N/C(=C/c3cccnc3)C(=O)O2)cc1C |
| InChI | InChI=1S/C17H14N2O2/c1-11-5-6-14(8-12(11)2)16-19-15(17(20)21-16)9-13-4-3-7-18-10-13/h3-10H,1-2H3/b15-9+ |
| InChIKey | SGXGRBBKTHKSIV-OQLLNIDSSA-N |
| XLogP | 3.04 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|