C25H38O — CID 10893615
2,2-dimethyl-3-[(3E,7E,11E,15Z)-3,7,12-trimethyloctadeca-3,7,11,15-tetraen-17-ynyl]oxirane (PubChem CID 10893615) has the molecular formula C25H38O and a molecular weight of 354.58 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3E,7E,11E,15Z)-3,7,12-trimethyloctadeca-3,7,11,15-tetraen-17-ynyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[(3E,7E,11E,15Z)-3,7,12-trimethyloctadeca-3,7,11,15-tetraen-17-ynyl]oxirane |
|---|---|
| PubChem CID | 10893615 |
| Molecular Formula | C25H38O |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | 2,2-dimethyl-3-[(3E,7E,11E,15Z)-3,7,12-trimethyloctadeca-3,7,11,15-tetraen-17-ynyl]oxirane |
| SMILES | C#C/C=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C25H38O/c1-7-8-9-10-14-21(2)15-11-12-16-22(3)17-13-18-23(4)19-20-24-25(5,6)26-24/h1,8-9,15-16,18,24H,10-14,17,19-20H2,2-6H3/b9-8-,21-15+,22-16+,23-18+ |
| InChIKey | YOCYMTAHLHQCBR-MBBSHWBZSA-N |
| XLogP | 7.31 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|