C20H19NO5 — CID 108936590
(4E)-4-[(3,4-dimethoxyphenyl)methylidene]-2-(2-phenoxyethyl)-1,3-oxazol-5-one (PubChem CID 108936590) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (4E)-4-[(3,4-dimethoxyphenyl)methylidene]-2-(2-phenoxyethyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(3,4-dimethoxyphenyl)methylidene]-2-(2-phenoxyethyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936590 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (4E)-4-[(3,4-dimethoxyphenyl)methylidene]-2-(2-phenoxyethyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(/C=C2/N=C(CCOc3ccccc3)OC2=O)cc1OC |
| InChI | InChI=1S/C20H19NO5/c1-23-17-9-8-14(13-18(17)24-2)12-16-20(22)26-19(21-16)10-11-25-15-6-4-3-5-7-15/h3-9,12-13H,10-11H2,1-2H3/b16-12+ |
| InChIKey | JDNYWYAIABQLNW-FOWTUZBSSA-N |
| XLogP | 3.47 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|