C21H21NO5 — CID 108936692
(4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-[2-(4-methoxyphenyl)ethyl]-1,3-oxazol-5-one (PubChem CID 108936692) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-[2-(4-methoxyphenyl)ethyl]-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-[2-(4-methoxyphenyl)ethyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936692 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-[2-(4-methoxyphenyl)ethyl]-1,3-oxazol-5-one |
| SMILES | COc1ccc(CCC2=N/C(=C\c3cc(OC)ccc3OC)C(=O)O2)cc1 |
| InChI | InChI=1S/C21H21NO5/c1-24-16-7-4-14(5-8-16)6-11-20-22-18(21(23)27-20)13-15-12-17(25-2)9-10-19(15)26-3/h4-5,7-10,12-13H,6,11H2,1-3H3/b18-13- |
| InChIKey | JDNTZJOUVCRXKJ-AQTBWJFISA-N |
| XLogP | 3.64 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|