C21H20FNO3 — CID 108937664
(4E)-4-[(5-ethyl-2-methoxyphenyl)methylidene]-2-[2-(3-fluorophenyl)ethyl]-1,3-oxazol-5-one (PubChem CID 108937664) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is (4E)-4-[(5-ethyl-2-methoxyphenyl)methylidene]-2-[2-(3-fluorophenyl)ethyl]-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(5-ethyl-2-methoxyphenyl)methylidene]-2-[2-(3-fluorophenyl)ethyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108937664 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (4E)-4-[(5-ethyl-2-methoxyphenyl)methylidene]-2-[2-(3-fluorophenyl)ethyl]-1,3-oxazol-5-one |
| SMILES | CCc1ccc(OC)c(/C=C2/N=C(CCc3cccc(F)c3)OC2=O)c1 |
| InChI | InChI=1S/C21H20FNO3/c1-3-14-7-9-19(25-2)16(11-14)13-18-21(24)26-20(23-18)10-8-15-5-4-6-17(22)12-15/h4-7,9,11-13H,3,8,10H2,1-2H3/b18-13+ |
| InChIKey | XXQQPKJWCIMNMJ-QGOAFFKASA-N |
| XLogP | 4.33 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|