C21H38O3Si — CID 10893905
ethyl (E)-5,5-dimethyl-4-tri(propan-2-yl)silyloxyoct-2-en-7-ynoate (PubChem CID 10893905) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is ethyl (E)-5,5-dimethyl-4-tri(propan-2-yl)silyloxyoct-2-en-7-ynoate.
| Compound Name | ethyl (E)-5,5-dimethyl-4-tri(propan-2-yl)silyloxyoct-2-en-7-ynoate |
|---|---|
| PubChem CID | 10893905 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | ethyl (E)-5,5-dimethyl-4-tri(propan-2-yl)silyloxyoct-2-en-7-ynoate |
| SMILES | C#CCC(C)(C)C(/C=C/C(=O)OCC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H38O3Si/c1-11-15-21(9,10)19(13-14-20(22)23-12-2)24-25(16(3)4,17(5)6)18(7)8/h1,13-14,16-19H,12,15H2,2-10H3/b14-13+ |
| InChIKey | VMCGQCBXWKLDOF-BUHFOSPRSA-N |
| XLogP | 5.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|