C22H31NO4 — CID 10894055
N-[(1E)-2-hydroxy-1-[(8S,9S,10R,11S,13S,14S)-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]ethyl]formamide (PubChem CID 10894055) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is N-[(1E)-2-hydroxy-1-[(8S,9S,10R,11S,13S,14S)-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]ethyl]formamide.
| Compound Name | N-[(1E)-2-hydroxy-1-[(8S,9S,10R,11S,13S,14S)-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]ethyl]formamide |
|---|---|
| PubChem CID | 10894055 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | N-[(1E)-2-hydroxy-1-[(8S,9S,10R,11S,13S,14S)-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]ethyl]formamide |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@]2(C)/C(=C(\CO)NC=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H31NO4/c1-21-8-7-14(26)9-13(21)3-4-15-16-5-6-17(18(11-24)23-12-25)22(16,2)10-19(27)20(15)21/h9,12,15-16,19-20,24,27H,3-8,10-11H2,1-2H3,(H,23,25)/b18-17+/t15-,16-,19-,20+,21-,22-/m0/s1 |
| InChIKey | WSEJRYWFGUWMNK-VSOLEMCSSA-N |
| XLogP | 2.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|