C14H25N3O5 — CID 108943286
ethyl 4-[3-(3-methoxypropylamino)-3-oxopropanoyl]piperazine-1-carboxylate (PubChem CID 108943286) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl 4-[3-(3-methoxypropylamino)-3-oxopropanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(3-methoxypropylamino)-3-oxopropanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108943286 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | ethyl 4-[3-(3-methoxypropylamino)-3-oxopropanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CC(=O)NCCCOC)CC1 |
| InChI | InChI=1S/C14H25N3O5/c1-3-22-14(20)17-8-6-16(7-9-17)13(19)11-12(18)15-5-4-10-21-2/h3-11H2,1-2H3,(H,15,18) |
| InChIKey | KXPAFYMNNMBMEH-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|