C14H19Cl2N3O2 — CID 108944302
N'-(2,4-dichlorophenyl)-N-[3-(dimethylamino)propyl]propanediamide (PubChem CID 108944302) has the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is N'-(2,4-dichlorophenyl)-N-[3-(dimethylamino)propyl]propanediamide.
| Compound Name | N'-(2,4-dichlorophenyl)-N-[3-(dimethylamino)propyl]propanediamide |
|---|---|
| PubChem CID | 108944302 |
| Molecular Formula | C14H19Cl2N3O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N'-(2,4-dichlorophenyl)-N-[3-(dimethylamino)propyl]propanediamide |
| SMILES | CN(C)CCCNC(=O)CC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N3O2/c1-19(2)7-3-6-17-13(20)9-14(21)18-12-5-4-10(15)8-11(12)16/h4-5,8H,3,6-7,9H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | QKMMYODUAFRBKE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|