C19H22N2O2 — CID 108946105
N'-benzyl-N-(2,3-dimethylphenyl)-N'-methylpropanediamide (PubChem CID 108946105) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N'-benzyl-N-(2,3-dimethylphenyl)-N'-methylpropanediamide.
| Compound Name | N'-benzyl-N-(2,3-dimethylphenyl)-N'-methylpropanediamide |
|---|---|
| PubChem CID | 108946105 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N'-benzyl-N-(2,3-dimethylphenyl)-N'-methylpropanediamide |
| SMILES | Cc1cccc(NC(=O)CC(=O)N(C)Cc2ccccc2)c1C |
| InChI | InChI=1S/C19H22N2O2/c1-14-8-7-11-17(15(14)2)20-18(22)12-19(23)21(3)13-16-9-5-4-6-10-16/h4-11H,12-13H2,1-3H3,(H,20,22) |
| InChIKey | VVPQFXDBMOHUMO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|