About N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide
N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide (PubChem CID 108946169) has the molecular formula C18H19BrN2O2
and a molecular weight of 375.27 g/mol. Its IUPAC name is N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide.
Molecular Properties
| Compound Name | N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide |
| PubChem CID | 108946169 |
| Molecular Formula | C18H19BrN2O2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CC(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H19BrN2O2/c1-13-10-15(19)8-9-16(13)20-17(22)11-18(23)21(2)12-14-6-4-3-5-7-14/h3-10H,11-12H2,1-2H3,(H,20,22) |
| InChIKey | GVUYWTCFIUPNCV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide?
The IUPAC name of N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide (CID 108946169) is N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide.
What is the SMILES notation for N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide?
The canonical SMILES for N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide is Cc1cc(Br)ccc1NC(=O)CC(=O)N(C)Cc1ccccc1.
What is the InChIKey of N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide?
The InChIKey is GVUYWTCFIUPNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrN2O2/c1-13-10-15(19)8-9-16(13)20-17(22)11-18(23)21(2)12-14-6-4-3-5-7-14/h3-10H,11-12H2,1-2H3,(H,20,22).
What are the key properties of N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide?
N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide has a molecular weight of 375.27 g/mol, XLogP of 3.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-(4-bromo-2-methylphenyl)-N'-methylpropanediamide is sourced from PubChem (CID 108946169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).