C17H13F4N3O2S — CID 10894617
3-fluoro-4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 10894617) has the molecular formula C17H13F4N3O2S and a molecular weight of 399.37 g/mol. Its IUPAC name is 3-fluoro-4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10894617 |
| Molecular Formula | C17H13F4N3O2S |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 3-fluoro-4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2F)cc1 |
| InChI | InChI=1S/C17H13F4N3O2S/c1-10-2-4-11(5-3-10)15-9-16(17(19,20)21)23-24(15)14-7-6-12(8-13(14)18)27(22,25)26/h2-9H,1H3,(H2,22,25,26) |
| InChIKey | PNBZQBAEHKYGKL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |