C17H16ClFN2O2 — CID 108948432
N'-(3-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]propanediamide (PubChem CID 108948432) has the molecular formula C17H16ClFN2O2 and a molecular weight of 334.78 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]propanediamide.
| Compound Name | N'-(3-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]propanediamide |
|---|---|
| PubChem CID | 108948432 |
| Molecular Formula | C17H16ClFN2O2 |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N'-(3-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(Cl)c1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16ClFN2O2/c18-13-2-1-3-15(10-13)21-17(23)11-16(22)20-9-8-12-4-6-14(19)7-5-12/h1-7,10H,8-9,11H2,(H,20,22)(H,21,23) |
| InChIKey | IYJLCQBFOSPTSI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|