C17H15Cl3N2O2 — CID 108949870
N-[2-(4-chlorophenyl)ethyl]-N'-(3,5-dichlorophenyl)propanediamide (PubChem CID 108949870) has the molecular formula C17H15Cl3N2O2 and a molecular weight of 385.68 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-N'-(3,5-dichlorophenyl)propanediamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-N'-(3,5-dichlorophenyl)propanediamide |
|---|---|
| PubChem CID | 108949870 |
| Molecular Formula | C17H15Cl3N2O2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-N'-(3,5-dichlorophenyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1cc(Cl)cc(Cl)c1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15Cl3N2O2/c18-12-3-1-11(2-4-12)5-6-21-16(23)10-17(24)22-15-8-13(19)7-14(20)9-15/h1-4,7-9H,5-6,10H2,(H,21,23)(H,22,24) |
| InChIKey | CMRLKGIRGYENAV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|