C23H22N2O2 — CID 1089488
N-[(1R)-1-(2,4-dimethylanilino)-2-oxo-2-phenylethyl]benzamide (PubChem CID 1089488) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dimethylanilino)-2-oxo-2-phenylethyl]benzamide.
| Compound Name | N-[(1R)-1-(2,4-dimethylanilino)-2-oxo-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 1089488 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[(1R)-1-(2,4-dimethylanilino)-2-oxo-2-phenylethyl]benzamide |
| SMILES | Cc1ccc(N[C@H](NC(=O)c2ccccc2)C(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H22N2O2/c1-16-13-14-20(17(2)15-16)24-22(21(26)18-9-5-3-6-10-18)25-23(27)19-11-7-4-8-12-19/h3-15,22,24H,1-2H3,(H,25,27)/t22-/m1/s1 |
| InChIKey | YXZNDLNRYSZJPF-JOCHJYFZSA-N |
| XLogP | 4.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|