C15H20N2O4S — CID 108949072
N'-(2,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)propanediamide (PubChem CID 108949072) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is N'-(2,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)propanediamide.
| Compound Name | N'-(2,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)propanediamide |
|---|---|
| PubChem CID | 108949072 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N'-(2,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)propanediamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)NC2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C15H20N2O4S/c1-10-3-4-13(11(2)7-10)17-15(19)8-14(18)16-12-5-6-22(20,21)9-12/h3-4,7,12H,5-6,8-9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | QMNWNOMYVQFYMV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|