C14H17BrN2O4S — CID 108949141
N'-(4-bromo-3-methylphenyl)-N-(1,1-dioxothiolan-3-yl)propanediamide (PubChem CID 108949141) has the molecular formula C14H17BrN2O4S and a molecular weight of 389.27 g/mol. Its IUPAC name is N'-(4-bromo-3-methylphenyl)-N-(1,1-dioxothiolan-3-yl)propanediamide.
| Compound Name | N'-(4-bromo-3-methylphenyl)-N-(1,1-dioxothiolan-3-yl)propanediamide |
|---|---|
| PubChem CID | 108949141 |
| Molecular Formula | C14H17BrN2O4S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | N'-(4-bromo-3-methylphenyl)-N-(1,1-dioxothiolan-3-yl)propanediamide |
| SMILES | Cc1cc(NC(=O)CC(=O)NC2CCS(=O)(=O)C2)ccc1Br |
| InChI | InChI=1S/C14H17BrN2O4S/c1-9-6-10(2-3-12(9)15)16-13(18)7-14(19)17-11-4-5-22(20,21)8-11/h2-3,6,11H,4-5,7-8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | FEOCFBFZYIJGDY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|