C17H20N2O6 — CID 108950080
N-(1,3-benzodioxol-5-yl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropanamide (PubChem CID 108950080) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108950080 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropanamide |
| SMILES | O=C(CC(=O)N1CCC2(CC1)OCCO2)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H20N2O6/c20-15(18-12-1-2-13-14(9-12)23-11-22-13)10-16(21)19-5-3-17(4-6-19)24-7-8-25-17/h1-2,9H,3-8,10-11H2,(H,18,20) |
| InChIKey | DNPIWKSACGHAIG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|