C16H18F2N2O4 — CID 108950105
N-(3,4-difluorophenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropanamide (PubChem CID 108950105) has the molecular formula C16H18F2N2O4 and a molecular weight of 340.33 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropanamide.
| Compound Name | N-(3,4-difluorophenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108950105 |
| Molecular Formula | C16H18F2N2O4 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropanamide |
| SMILES | O=C(CC(=O)N1CCC2(CC1)OCCO2)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H18F2N2O4/c17-12-2-1-11(9-13(12)18)19-14(21)10-15(22)20-5-3-16(4-6-20)23-7-8-24-16/h1-2,9H,3-8,10H2,(H,19,21) |
| InChIKey | QFPZEMGLKDVVST-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|