C22H27N3O4 — CID 108950812
N-(2-tert-butylphenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropanamide (PubChem CID 108950812) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropanamide.
| Compound Name | N-(2-tert-butylphenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 108950812 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-(2-tert-butylphenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropanamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)CC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C22H27N3O4/c1-22(2,3)16-7-4-5-8-17(16)23-19(26)15-20(27)24-10-12-25(13-11-24)21(28)18-9-6-14-29-18/h4-9,14H,10-13,15H2,1-3H3,(H,23,26) |
| InChIKey | XPZRIEQQKUBAMI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|