C18H20ClN5O2 — CID 108950998
N-(4-chloro-2-methylphenyl)-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide (PubChem CID 108950998) has the molecular formula C18H20ClN5O2 and a molecular weight of 373.84 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 108950998 |
| Molecular Formula | C18H20ClN5O2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H20ClN5O2/c1-13-11-14(19)3-4-15(13)22-16(25)12-17(26)23-7-9-24(10-8-23)18-20-5-2-6-21-18/h2-6,11H,7-10,12H2,1H3,(H,22,25) |
| InChIKey | KTAPRXNZXFNWEY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|