C23H26N2O4 — CID 108952167
methyl 2-[[3-(4-benzylpiperidin-1-yl)-3-oxopropanoyl]amino]benzoate (PubChem CID 108952167) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl 2-[[3-(4-benzylpiperidin-1-yl)-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 2-[[3-(4-benzylpiperidin-1-yl)-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108952167 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl 2-[[3-(4-benzylpiperidin-1-yl)-3-oxopropanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CC(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N2O4/c1-29-23(28)19-9-5-6-10-20(19)24-21(26)16-22(27)25-13-11-18(12-14-25)15-17-7-3-2-4-8-17/h2-10,18H,11-16H2,1H3,(H,24,26) |
| InChIKey | ZPXYONPBFXROEO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|