C16H23FN2O2 — CID 108957212
N-[2-(2-fluorophenyl)ethyl]-2,2-dimethyl-N'-propan-2-ylpropanediamide (PubChem CID 108957212) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-2,2-dimethyl-N'-propan-2-ylpropanediamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-2,2-dimethyl-N'-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 108957212 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-2,2-dimethyl-N'-propan-2-ylpropanediamide |
| SMILES | CC(C)NC(=O)C(C)(C)C(=O)NCCc1ccccc1F |
| InChI | InChI=1S/C16H23FN2O2/c1-11(2)19-15(21)16(3,4)14(20)18-10-9-12-7-5-6-8-13(12)17/h5-8,11H,9-10H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | UIDZLZIOJDGJOU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|