C18H26N2O3 — CID 108958662
N-cyclopentyl-N'-(2-methoxy-5-methylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108958662) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-cyclopentyl-N'-(2-methoxy-5-methylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-cyclopentyl-N'-(2-methoxy-5-methylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108958662 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-cyclopentyl-N'-(2-methoxy-5-methylphenyl)-2,2-dimethylpropanediamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(C)(C)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H26N2O3/c1-12-9-10-15(23-4)14(11-12)20-17(22)18(2,3)16(21)19-13-7-5-6-8-13/h9-11,13H,5-8H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | POUIASMCKKSVFJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|