C15H28N2O2 — CID 108958979
N-tert-butyl-N'-cyclohexyl-2,2-dimethylpropanediamide (PubChem CID 108958979) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-tert-butyl-N'-cyclohexyl-2,2-dimethylpropanediamide.
| Compound Name | N-tert-butyl-N'-cyclohexyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108958979 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | N-tert-butyl-N'-cyclohexyl-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C)NC(=O)C(C)(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H28N2O2/c1-14(2,3)17-13(19)15(4,5)12(18)16-11-9-7-6-8-10-11/h11H,6-10H2,1-5H3,(H,16,18)(H,17,19) |
| InChIKey | QZCHFSYHNPATTC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|