C18H25BrN2O2 — CID 108959255
N-(4-bromo-2-methylphenyl)-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide (PubChem CID 108959255) has the molecular formula C18H25BrN2O2 and a molecular weight of 381.31 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108959255 |
| Molecular Formula | C18H25BrN2O2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)C(C)(C)C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C18H25BrN2O2/c1-12-7-9-21(10-8-12)17(23)18(3,4)16(22)20-15-6-5-14(19)11-13(15)2/h5-6,11-12H,7-10H2,1-4H3,(H,20,22) |
| InChIKey | RUCVLVRDWDAHFK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|