C17H23ClN2O2 — CID 108959205
N-(2-chlorophenyl)-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide (PubChem CID 108959205) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide.
| Compound Name | N-(2-chlorophenyl)-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108959205 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(2-chlorophenyl)-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide |
| SMILES | CC1CCN(C(=O)C(C)(C)C(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-12-8-10-20(11-9-12)16(22)17(2,3)15(21)19-14-7-5-4-6-13(14)18/h4-7,12H,8-11H2,1-3H3,(H,19,21) |
| InChIKey | RKAROZHFGJDMSA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|