C18H22ClF3N2O2 — CID 108959266
N-[4-chloro-2-(trifluoromethyl)phenyl]-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide (PubChem CID 108959266) has the molecular formula C18H22ClF3N2O2 and a molecular weight of 390.83 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108959266 |
| Molecular Formula | C18H22ClF3N2O2 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2,2-dimethyl-3-(4-methylpiperidin-1-yl)-3-oxopropanamide |
| SMILES | CC1CCN(C(=O)C(C)(C)C(=O)Nc2ccc(Cl)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H22ClF3N2O2/c1-11-6-8-24(9-7-11)16(26)17(2,3)15(25)23-14-5-4-12(19)10-13(14)18(20,21)22/h4-5,10-11H,6-9H2,1-3H3,(H,23,25) |
| InChIKey | DIEMUFFEHJWKLZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|