C19H27N3O4 — CID 108960867
N-(1,3-benzodioxol-5-ylmethyl)-3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanamide (PubChem CID 108960867) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108960867 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanamide |
| SMILES | CCN1CCN(C(=O)C(C)(C)C(=O)NCc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H27N3O4/c1-4-21-7-9-22(10-8-21)18(24)19(2,3)17(23)20-12-14-5-6-15-16(11-14)26-13-25-15/h5-6,11H,4,7-10,12-13H2,1-3H3,(H,20,23) |
| InChIKey | RFTKHYOYTPPQID-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|