C20H23ClN2O3 — CID 108963070
N-(3-chloro-2-methylphenyl)-N'-[(4-methoxyphenyl)methyl]-2,2-dimethylpropanediamide (PubChem CID 108963070) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-[(4-methoxyphenyl)methyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-[(4-methoxyphenyl)methyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108963070 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-[(4-methoxyphenyl)methyl]-2,2-dimethylpropanediamide |
| SMILES | COc1ccc(CNC(=O)C(C)(C)C(=O)Nc2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C20H23ClN2O3/c1-13-16(21)6-5-7-17(13)23-19(25)20(2,3)18(24)22-12-14-8-10-15(26-4)11-9-14/h5-11H,12H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | OBNPHQTVXWBKMM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|