C20H25ClN4O2 — CID 111182357
N-(3-chloro-2-methylphenyl)-3-[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propanamide (PubChem CID 111182357) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111182357 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)Nc1cccc(Cl)c1C)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-14-17(21)5-4-6-18(14)25-19(26)11-12-23-20(22-2)24-13-15-7-9-16(27-3)10-8-15/h4-10H,11-13H2,1-3H3,(H,25,26)(H2,22,23,24) |
| InChIKey | JLNHZYILMSAWPG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|