C13H19ClN4O — CID 110927766
N-(3-chloro-2-methylphenyl)-3-[(N,N'-dimethylcarbamimidoyl)amino]propanamide (PubChem CID 110927766) has the molecular formula C13H19ClN4O and a molecular weight of 282.78 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[(N,N'-dimethylcarbamimidoyl)amino]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[(N,N'-dimethylcarbamimidoyl)amino]propanamide |
|---|---|
| PubChem CID | 110927766 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[(N,N'-dimethylcarbamimidoyl)amino]propanamide |
| SMILES | C/N=C(\NC)NCCC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C13H19ClN4O/c1-9-10(14)5-4-6-11(9)18-12(19)7-8-17-13(15-2)16-3/h4-6H,7-8H2,1-3H3,(H,18,19)(H2,15,16,17) |
| InChIKey | UWDRHEILZXTPTM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|